Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Pitavastatin Calcium is a competitive inhibitor of the enzyme HMGCR (HMG-CoA reductase) results in a reduction in LDL cholesterol synthesis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10737 |
|---|---|
| Formula | (C25H23FNO4)2.Ca |
| Molecular Weight | 880.98 |
| CAS Number | 147526-32-7 |
| SMILES | C1C(C1)C2=NC3=CC=CC=C3C(=C2/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])C4=CC=C(C=C4)F.C1C(C1)C2=NC3=CC=CC=C3C(=C2/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])C4=CC=C(C=C4)F.[Ca+2] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (52.21 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 11.35 mL | 56.75 mL | 113.51 mL |
| 0.5 mM | 2.27 mL | 11.35 mL | 22.7 mL |
| 1 mM | 1.14 mL | 5.68 mL | 11.35 mL |
| 5 mM | 0.23 mL | 1.14 mL | 2.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
