Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Pivmecillinam hydrochloride is active against gram-negative organisms and used as for amdinocillin. Pivmecillinam is an orally active prodrug of mecillinam, an extended-spectrum penicillin antibiotic. |
|---|
| Catalog Num | A17643 |
|---|---|
| Formula | C21H34ClN3O5S |
| Molecular Weight | 476.03 |
| CAS Number | 32887-03-9 |
| SMILES | CC1(C(N2C(S1)C(C2=O)N=CN3CCCCCC3)C(=O)OCOC(=O)C(C)(C)C)C.Cl |
| Synonyms | Pivmecillinam Hydrochloride; Melysin; Pivmecillinam (hydrochloride); UNII-48FX7N21H2; Pivmecilinamo clorhidrato [Spanish]; Pivmecillinam Hydrochloride; Pivoxil, Amdinocillin; Selexid; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (170.15 mM) | |
| Water | 81 mg/mL (170.15 mM) | ||
| Ethanol | 81 mg/mL (170.15 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.01 mL | 105.04 mL | 210.07 mL |
| 0.5 mM | 4.2 mL | 21.01 mL | 42.01 mL |
| 1 mM | 2.1 mL | 10.5 mL | 21.01 mL |
| 5 mM | 0.42 mL | 2.1 mL | 4.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
