Loading distributor info...
| Description | PS372424, a three amino-acid fragment of CXCL10, is a specific human CXCR3 agonist with anti-inflammatory activity, which inhibits the binding of CXCR3 ligand CXCL10 to CXCR3 receptor with IC50 of 42 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19421 |
|---|---|
| Formula | C33H44N6O4 |
| Molecular Weight | 588.74 |
| CAS Number | 914291-61-5 |
| SMILES | O=C([C@H]1N(C(CCC(C2=CC=CC=C2)=O)=O)CC3=C(C=CC=C3)C1)N[C@H](C(NCC4CCCCC4)=O)CCCNC(N)=N |
| Synonyms | PS 372424, PS-372424 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
