Loading distributor info...
| Description | Pyridoxyl phosphate is a purinergic P2 receptor antagonist potentially for the treatment of tardive dyskinesia | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17592 |
|---|---|
| Formula | C8H10NO6P |
| Molecular Weight | 247.14 |
| CAS Number | 54-47-7 |
| SMILES | O=CC1=C(O)C(C)=NC=C1COP(O)(O)=O |
| Synonyms | MC-1; MC1; MC 1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (36.41 mM) | |
| Water | 6 mg/mL (24.27 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.46 mL | 202.31 mL | 404.63 mL |
| 0.5 mM | 8.09 mL | 40.46 mL | 80.93 mL |
| 1 mM | 4.05 mL | 20.23 mL | 40.46 mL |
| 5 mM | 0.81 mL | 4.05 mL | 8.09 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
