Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Reparixin is a potent inhibitor of both CXCL8 receptors CXCR1/2, it inhibits weakly CXCR2-mediated cell migration (IC50=100 nM), whereas it strongly blocks CXCR1-mediated chemotaxis (IC50=1 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12383 |
|---|---|
| Formula | C14H21NO3S |
| Molecular Weight | 283.39 |
| CAS Number | 266359-83-5 |
| SMILES | C[C@H](C1=CC=C(C=C1)CC(C)C)C(=O)NS(=O)(=O)C |
| Synonyms | DF 1681Y; Repertaxin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (183.49 mM) | |
| Water | Insoluble | ||
| Ethanol | 52 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.29 mL | 176.44 mL | 352.87 mL |
| 0.5 mM | 7.06 mL | 35.29 mL | 70.57 mL |
| 1 mM | 3.53 mL | 17.64 mL | 35.29 mL |
| 5 mM | 0.71 mL | 3.53 mL | 7.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
