Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Resminostat, also known as RAS2410, is a potent inhibitor of histone deacetylase (HDAC) classes I and II. It binds to and inhibits HDACs leading to an accumulation of highly acetylated histones. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12556 |
|---|---|
| Formula | C16H19N3O4S |
| Molecular Weight | 349.4 |
| CAS Number | 864814-88-0 |
| SMILES | CN(C)CC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)/C=C/C(=O)NO |
| Synonyms | 4SC-201, RAS2410 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (194.62 mM) | |
| Water | Insoluble | ||
| Ethanol | 68 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.62 mL | 143.1 mL | 286.2 mL |
| 0.5 mM | 5.72 mL | 28.62 mL | 57.24 mL |
| 1 mM | 2.86 mL | 14.31 mL | 28.62 mL |
| 5 mM | 0.57 mL | 2.86 mL | 5.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
