Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Santacruzamate A (CAY10683) is a potent and selective HDAC inhibitor with IC50 of 119 pM for HDAC2, >3600-fold selectivity over other HDACs. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14236 |
|---|---|
| Formula | C15H22N2O3 |
| Molecular Weight | 278.35 |
| CAS Number | 1477949-42-0 |
| SMILES | CCOC(=O)NCCCC(=O)NCCC1=CC=CC=C1 |
| Synonyms | CAY10683 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 47 mg/mL (168.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 47 mg/mL (168.85 mM) | ||
| In vivo | 5%DMSO+30%PEG300+5%TW80+H2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.93 mL | 179.63 mL | 359.26 mL |
| 0.5 mM | 7.19 mL | 35.93 mL | 71.85 mL |
| 1 mM | 3.59 mL | 17.96 mL | 35.93 mL |
| 5 mM | 0.72 mL | 3.59 mL | 7.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
