Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Scriptaid is an HDAC inhibitor (histone deacetylase). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12722 |
|---|---|
| Formula | C18H18N2O4 |
| Molecular Weight | 326.35 |
| CAS Number | 287383-59-9 |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)CCCCCC(=O)NO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 60 mg/mL (183.85 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 6 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.64 mL | 153.21 mL | 306.42 mL |
| 0.5 mM | 6.13 mL | 30.64 mL | 61.28 mL |
| 1 mM | 3.06 mL | 15.32 mL | 30.64 mL |
| 5 mM | 0.61 mL | 3.06 mL | 6.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
