Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | SGI-1776 free base is a novel ATP competitive inhibitor of Pim1 with IC50 of 7 nM in a cell-free assay, 50- and 10-fold selective versus Pim2 and Pim3, also potent to Flt3 and haspin. Phase 1. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10838 |
|---|---|
| Formula | C20H22F3N5O |
| Molecular Weight | 405.4 |
| CAS Number | 1025065-69-3 |
| SMILES | CN1CCC(CC1)CNC2=NN3C(=NC=C3C4=CC(=CC=C4)OC(F)(F)F)C=C2 |
| Synonyms | SGI1776 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 70 mg/mL (172.66 mM) | |
| Water | Insoluble | ||
| Ethanol | 70 mg/mL (172.66 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.67 mL | 123.33 mL | 246.67 mL |
| 0.5 mM | 4.93 mL | 24.67 mL | 49.33 mL |
| 1 mM | 2.47 mL | 12.33 mL | 24.67 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
