Loading distributor info...
| Description | SKLB-23bb is a potent and selective inhibitor for HDAC6 with an IC50 of 17 nM and shows 25-fold and 200-fold selectivity relative to HDAC1 (IC50=422 nM) and HDAC8 (IC50=3398 nM), respectively. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A18339 |
|---|---|
| Formula | C21H24N4O4 |
| Molecular Weight | 396.447 |
| CAS Number | 1815580-06-3 |
| SMILES | O=C(NO)CCCOC1=CC(N(C)C2=C3C=CC=CC3=NC(C)=N2)=CC=C1OC |
| Synonyms | SKLB 23bb, SKLB23bb |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (191.7 mM) | |
| Water | Insoluble | ||
| Ethanol | 76 mg/mL (191.7 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.22 mL | 126.12 mL | 252.24 mL |
| 0.5 mM | 5.04 mL | 25.22 mL | 50.45 mL |
| 1 mM | 2.52 mL | 12.61 mL | 25.22 mL |
| 5 mM | 0.5 mL | 2.52 mL | 5.04 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
