Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sodium phenylbutyrate is an inhibitor of HDAC and endoplasmic reticulum (ER) stress, used in cancer and infection research. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16714 |
|---|---|
| Formula | C10H11NaO2 |
| Molecular Weight | 186.18 |
| CAS Number | 1716-12-7 |
| SMILES | [O-]C(CCCC1=CC=CC=C1)=O.[Na+] |
| Synonyms | Sodium 4-phenylbutyrate; TriButyrate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (37.59 mM) | |
| Water | 27 mg/mL (145.02 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 53.71 mL | 268.56 mL | 537.11 mL |
| 0.5 mM | 10.74 mL | 53.71 mL | 107.42 mL |
| 1 mM | 5.37 mL | 26.86 mL | 53.71 mL |
| 5 mM | 1.07 mL | 5.37 mL | 10.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
