Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Splitomicin is a selective NAD(+)-dependent histone deacetylase Sir2p inhibitor with IC50 of 60 uM, showing a higher activity in a cell-based assay. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14221 |
|---|---|
| Formula | C13H10O2 |
| Molecular Weight | 198.22 |
| CAS Number | CAS: 5690-03-9 |
| SMILES | C1CC(=O)OC2=C1C3=CC=CC=C3C=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (186.66 mM) | |
| Water | Insoluble | ||
| Ethanol | 37 mg/mL (186.66 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 50.45 mL | 252.24 mL | 504.49 mL |
| 0.5 mM | 10.09 mL | 50.45 mL | 100.9 mL |
| 1 mM | 5.04 mL | 25.22 mL | 50.45 mL |
| 5 mM | 1.01 mL | 5.04 mL | 10.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
