Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | TAME is a small molecule anaphase-promoting complex/cyclosome (APC) inhibitor with an IC50 of 12 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10884 |
|---|---|
| Formula | C14H22N4O4S |
| Molecular Weight | 342.42 |
| CAS Number | 901-47-3 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (198.59 mM) | |
| Water | 68 mg/mL (198.59 mM) | ||
| Ethanol | 3 mg/mL (8.76 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.2 mL | 146.02 mL | 292.04 mL |
| 0.5 mM | 5.84 mL | 29.2 mL | 58.41 mL |
| 1 mM | 2.92 mL | 14.6 mL | 29.2 mL |
| 5 mM | 0.58 mL | 2.92 mL | 5.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
