Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Tanshinone IIA (TIIA) is one of the major extracts obtained from Salvia miltiorrhiza BUNGE, which has anti-inflammatory and anti-apoptotic effects on many diseases. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10890 |
|---|---|
| Formula | C19H18O3 |
| Molecular Weight | 294.3 |
| CAS Number | 568-72-9 |
| SMILES | CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C |
| Synonyms | Tanshinone B, Tanshinone II |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 4 mg/mL (13.58 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+30% PEG 300+2% Tween 80+ddH2O | 0.1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.98 mL | 169.89 mL | 339.79 mL |
| 0.5 mM | 6.8 mL | 33.98 mL | 67.96 mL |
| 1 mM | 3.4 mL | 16.99 mL | 33.98 mL |
| 5 mM | 0.68 mL | 3.4 mL | 6.8 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
