Loading distributor info...
| Description | TCS PIM-1 4a is a selective and ATP-competitive Pim kinase inhibitor (IC50 values = 24 and 100 nM for Pim-1 and Pim-2, respectively). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A11967 |
|---|---|
| Formula | C11H6F3NO2S |
| Molecular Weight | 273.23 |
| CAS Number | 438190-29-5 |
| SMILES | O=C(NC/1=O)SC1=C\C2=CC=CC(C(F)(F)F)=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 47 mg/mL (172.01 mM) | |
| Water | Insoluble | ||
| Ethanol | 28 mg/mL (102.47 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.6 mL | 183 mL | 365.99 mL |
| 0.5 mM | 7.32 mL | 36.6 mL | 73.2 mL |
| 1 mM | 3.66 mL | 18.3 mL | 36.6 mL |
| 5 mM | 0.73 mL | 3.66 mL | 7.32 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
