Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EDO-S101 is a pan HDAC inhibitor; inhibits HDAC1, HDAC2 and HDAC3 with IC50 values of 9, 9 and 25 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18342 |
|---|---|
| Formula | C19H28Cl2N4O2 |
| Molecular Weight | 415.359 |
| CAS Number | 1236199-60-2 |
| SMILES | O=C(NO)CCCCCCC1=NC2=CC(N(CCCl)CCCl)=CC=C2N1C |
| Synonyms | EDOS101, EDO S101 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 12 mg/mL (28.89 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (4.81 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.08 mL | 120.38 mL | 240.76 mL |
| 0.5 mM | 4.82 mL | 24.08 mL | 48.15 mL |
| 1 mM | 2.41 mL | 12.04 mL | 24.08 mL |
| 5 mM | 0.48 mL | 2.41 mL | 4.82 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
