Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tofacitinib is an orally available JAK3/2/1 inhibitor with IC50s of 1, 20, and 112 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17252 |
|---|---|
| Formula | C16H20N6O |
| Molecular Weight | 312.37 |
| CAS Number | 477600-75-2 |
| SMILES | O=C(CC#N)N1C[C@H](N(C2=C3C(NC=C3)=NC=N2)C)[C@H](C)CC1 |
| Synonyms | Tasocitinib; CP-690550 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 56 mg/mL (179.27 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.01 mL | 160.07 mL | 320.13 mL |
| 0.5 mM | 6.4 mL | 32.01 mL | 64.03 mL |
| 1 mM | 3.2 mL | 16.01 mL | 32.01 mL |
| 5 mM | 0.64 mL | 3.2 mL | 6.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
