Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | CP-690550 (Tofacitinib citrate) is an orally available, highly selective inhibitor of the Janus kinase (JAK) family of enzymes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10241 |
|---|---|
| Formula | C16H20N6O.C6H8O7 |
| Molecular Weight | 504.5 |
| CAS Number | 540737-29-9 |
| SMILES | C[C@@H]1CCN(C[C@@H]1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 94 mg/mL (186.32 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.82 mL | 99.11 mL | 198.22 mL |
| 0.5 mM | 3.96 mL | 19.82 mL | 39.64 mL |
| 1 mM | 1.98 mL | 9.91 mL | 19.82 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
