Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TP-3654 is a second-generation Pim kinase inhibitor with Ki values of 5 and 42 nM for Pim-1 and Pim-3, respectively. |
|---|
| Catalog Num | A20584 |
|---|---|
| Formula | C22H25F3N4O |
| Molecular Weight | 418.46 |
| CAS Number | 1361951-15-6 |
| SMILES | OC(C)(C)[C@H]1CC[C@H](NC2=NN3C(C=C2)=NC=C3C4=CC=CC(C(F)(F)F)=C4)CC1 |
| Synonyms | TP3654, TP 3654 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (169.66 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (11.94 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.9 mL | 119.49 mL | 238.97 mL |
| 0.5 mM | 4.78 mL | 23.9 mL | 47.79 mL |
| 1 mM | 2.39 mL | 11.95 mL | 23.9 mL |
| 5 mM | 0.48 mL | 2.39 mL | 4.78 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
