Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tucidinostat is a potent and orally bioavailable HDAC enzymes class I (HDAC1/2/3) and class IIb (HDAC10) inhibitor, with IC50s of 95, 160, 67 and 78 nM, less active on HDAC8 and HDAC11 (IC50s, 733 nM, 432 nM, respectively), and shows no effect on HDAC4/5/6/7/9. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17861 |
|---|---|
| Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 |
| CAS Number | 1616493-44-7 |
| SMILES | O=C(NC1=CC=C(F)C=C1N)C2=CC=C(CNC(/C=C/C3=CC=CN=C3)=O)C=C2 |
| Synonyms | Tucidinostat; HBI-8000; HBI 8000; HBI8000 Chidamide; CS-055; CS 055; CS055 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 69 mg/mL (176.73 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (5.12 mM) | ||
| In vivo | 1% CMC Na | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.61 mL | 128.07 mL | 256.13 mL |
| 0.5 mM | 5.12 mL | 25.61 mL | 51.23 mL |
| 1 mM | 2.56 mL | 12.81 mL | 25.61 mL |
| 5 mM | 0.51 mL | 2.56 mL | 5.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
