Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | U0126-EtOH is an inhibitor of both MEK1 and MEK2 with an IC50 of 72 nM and 58 nM respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10957 |
|---|---|
| Formula | C18H16N6S2.C2H6O |
| Molecular Weight | 426.6 |
| CAS Number | 1173097-76-1 |
| SMILES | CCO.C1=CC=C(C(=C1)N)S/C(=C(/C(=C(/SC2=CC=CC=C2N)\N)/C#N)\C#N)/N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 77 mg/mL (180.51 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5%DMSO+40%PEG300+5%Tween 80+50%H2O | 4.03 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.44 mL | 117.21 mL | 234.41 mL |
| 0.5 mM | 4.69 mL | 23.44 mL | 46.88 mL |
| 1 mM | 2.34 mL | 11.72 mL | 23.44 mL |
| 5 mM | 0.47 mL | 2.34 mL | 4.69 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
