Signaling Pathway
nAChR agonist
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Varenicline Tartrate(CP 526555;Champix) is a nicotinic receptor partial agonist; it stimulates nicotine receptors more weakly than nicotine itself does. |
|---|
| Catalog Num | A11618 |
|---|---|
| Formula | C17H19N3O6 |
| Molecular Weight | 361.35 |
| CAS Number | 375815-87-5 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(O)=O.C1(C2CC3CNC2)=C3C=C(N=CC=N4)C4=C1 |
| Synonyms | CP 526555-18 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (2.76 mM) | |
| Water | 61 mg/mL (168.81 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.67 mL | 138.37 mL | 276.74 mL |
| 0.5 mM | 5.53 mL | 27.67 mL | 55.35 mL |
| 1 mM | 2.77 mL | 13.84 mL | 27.67 mL |
| 5 mM | 0.55 mL | 2.77 mL | 5.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
