Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | VE-822 is an potent ATR inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13289 |
|---|---|
| Formula | C24H25N5O3S |
| Molecular Weight | 463.55 |
| CAS Number | 1232416-25-9 |
| SMILES | CC(C)S(=O)(=O)C1=CC=C(C=C1)C2=CN=C(C(=N2)C3=CC(=NO3)C4=CC=C(C=C4)CNC)N |
| Synonyms | VE822, VE 822 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 36 mg/mL (77.66 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+45% PEG 300+H2O | 10 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.57 mL | 107.86 mL | 215.73 mL |
| 0.5 mM | 4.31 mL | 21.57 mL | 43.15 mL |
| 1 mM | 2.16 mL | 10.79 mL | 21.57 mL |
| 5 mM | 0.43 mL | 2.16 mL | 4.31 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
