Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Zalcitabine is a potent nucleoside analogue reverse transcriptase inhibitor used in the treatment of HIV infection. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11005 |
|---|---|
| Formula | C9H13N3O3 |
| Molecular Weight | 211.22 |
| CAS Number | 7481-89-2 |
| SMILES | OC[C@@H]1CC[C@H](N2C(N=C(C=C2)N)=O)O1 |
| Synonyms | 2',3'-Dideoxycytidine; ddC; Dideoxycytidine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (33.14 mM) | |
| Water | 41 mg/mL (194.11 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 47.34 mL | 236.72 mL | 473.44 mL |
| 0.5 mM | 9.47 mL | 47.34 mL | 94.69 mL |
| 1 mM | 4.73 mL | 23.67 mL | 47.34 mL |
| 5 mM | 0.95 mL | 4.73 mL | 9.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
