Loading distributor info...
| Description | S-Ruxolitinib is the chirality of INCB018424, is a potent and selective small-molecule Janus kinase 1 (JAK1) and JAK2 inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14955 |
|---|---|
| Formula | C17H18N6 |
| Molecular Weight | 306.37 |
| CAS Number | 941685-37-6 |
| SMILES | C1CCC(C1)C(CC#N)N2C=C(C=N2)C3=C4C=CNC4=NC=N3 |
| Synonyms | INCB018424 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 59 mg/mL (192.57 mM) | |
| Water | 5 mg/mL (16.32 mM) | ||
| Ethanol | 59 mg/mL (192.57 mM) | ||
| In vivo | 0.5% CMC+0.25% Tween 80 | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.64 mL | 163.2 mL | 326.4 mL |
| 0.5 mM | 6.53 mL | 32.64 mL | 65.28 mL |
| 1 mM | 3.26 mL | 16.32 mL | 32.64 mL |
| 5 mM | 0.65 mL | 3.26 mL | 6.53 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
