Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ruxolitinib Phosphate is the phosphate salt form of ruxolitinib, an orally bioavailable Janus-associated kinase (JAK) inhibitor with potential antineoplastic and immunomodulating activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11552 |
|---|---|
| Formula | C17H21N6O4P |
| Molecular Weight | 404.37 |
| CAS Number | 1092939-17-7 |
| SMILES | N#CC[C@@H](N1N=CC(C2=C3C(NC=C3)=NC=N2)=C1)C4CCCC4.O=P(O)(O)O |
| Synonyms | INCB018424, INCB 018424, INCB-018424 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (180.53 mM) | |
| Water | 26 mg/mL (64.29 mM) | ||
| Ethanol | 7 mg/mL (17.31 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.73 mL | 123.65 mL | 247.3 mL |
| 0.5 mM | 4.95 mL | 24.73 mL | 49.46 mL |
| 1 mM | 2.47 mL | 12.36 mL | 24.73 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
