Aloe emodin is a anthraquinone present in aloe latex, an exudate from the aloe plant. It has a strong stimulant-laxative action.
Loading distributor info...
| Description | Aloe emodin is a anthraquinone present in aloe latex, an exudate from the aloe plant. It has a strong stimulant-laxative action. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10057 |
|---|---|
| Formula | C15H10O5 |
| Molecular Weight | 270.2 |
| CAS Number | 481-72-1 |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C=C(C=C3C2=O)CO)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 3 mg/mL (11.1 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.01 mL | 185.05 mL | 370.1 mL |
| 0.5 mM | 7.4 mL | 37.01 mL | 74.02 mL |
| 1 mM | 3.7 mL | 18.5 mL | 37.01 mL |
| 5 mM | 0.74 mL | 3.7 mL | 7.4 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
