Avermectin B1
Catalog No.: A12539
Avermectin B1 (Abamectin) is a widely used insecticide and anthelmintic.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Avermectin B1 (Abamectin) is a widely used insecticide and anthelmintic. |
|---|
| Catalog Num | A12539 |
|---|---|
| Formula | C95H142O28 |
| Molecular Weight | 1732.13 |
| CAS Number | 71751-41-2 |
| SMILES | C[C@@H](CC)[C@]1([H])[C@@H](C)C=C[C@@]2(O[C@@]3([H])C[C@]([H])(OC([C@@]4([H])[C@@](/C(CO5)=C/C=C/[C@H](C)[C@H](O[C@@]6([H])C[C@H](OC)[C@@H](O[C@]7([H])O[C@@H](C)[C@H](O)[C@@H](OC)C7)[C@H](C)O6)/C(C)=C/C3)(O)[C@@]5([H])[C@H](O)C(C)=C4)=O)C2)O1.C[C@H]8C=C[C@@]9(O[C@@]%10([H])C[C@]([H])(OC([C@@]%11([H])[C@@](/C(CO%12)=C/C=C/[C@H](C)[C@H](O[C@@]%13([H])C[C@H](OC)[C@@H](O[C@]%14([H])O[C@@H](C)[C@H](O)[C@@H](OC)C%14)[C@H](C)O%13)/C(C)=C/C%10)(O)[C@@]%12([H])[C@H](O)C(C)=C%11)=O)C9)O[C@@H]8C(C)C |
| Synonyms | Abamectin; Avermectin B1a-Avermectin B1b mixt |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (108.8 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 5.77 mL | 28.87 mL | 57.73 mL |
| 0.5 mM | 1.15 mL | 5.77 mL | 11.55 mL |
| 1 mM | 0.58 mL | 2.89 mL | 5.77 mL |
| 5 mM | 0.12 mL | 0.58 mL | 1.15 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2