Loading distributor info...
| Description | Azamethiphos is an organothiophosphate insecticide. It is a veterinary drug used in Atlantic salmon fish farming to control parasites. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17520 |
|---|---|
| Formula | C9H10ClN2O5PS |
| Molecular Weight | 324.67 |
| CAS Number | 35575-96-3 |
| SMILES | O=P(OC)(SCN(C1=NC=C(Cl)C=C1O2)C2=O)OC |
| Synonyms | Azamethiphos; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (178.63 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.8 mL | 154 mL | 308.01 mL |
| 0.5 mM | 6.16 mL | 30.8 mL | 61.6 mL |
| 1 mM | 3.08 mL | 15.4 mL | 30.8 mL |
| 5 mM | 0.62 mL | 3.08 mL | 6.16 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
