AZD1208
AZD1208 is orally available, small molecule inhibitor of PIM kinases with potential antineoplastic activity.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | AZD1208 is orally available, small molecule inhibitor of PIM kinases with potential antineoplastic activity. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13203 |
|---|---|
| Formula | C21H21N3O2S |
| Molecular Weight | 379.48 |
| CAS Number | 1204144-28-4 |
| SMILES | C1C[C@H](CN(C1)C2=C(C=CC=C2/C=C\3/C(=O)NC(=O)S3)C4=CC=CC=C4)N |
| Synonyms | AZD 1208, AZD-1208 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 70 mg/mL (184.45 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.35 mL | 131.76 mL | 263.52 mL |
| 0.5 mM | 5.27 mL | 26.35 mL | 52.7 mL |
| 1 mM | 2.64 mL | 13.18 mL | 26.35 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.27 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2