Loading distributor info...
| Description | Carprofen reduces inflammation by inhibition of COX-2 and other sources of inflammatory prostaglandins, does not interfere with COX-1 activity. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A16428 |
|---|---|
| Formula | C15H12ClNO2 |
| Molecular Weight | 273.71 |
| CAS Number | 53716-49-7 |
| SMILES | CC(C1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl)C(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (189.98 mM) | |
| Water | Insoluble | ||
| Ethanol | 52 mg/mL (189.98 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.54 mL | 182.68 mL | 365.35 mL |
| 0.5 mM | 7.31 mL | 36.54 mL | 73.07 mL |
| 1 mM | 3.65 mL | 18.27 mL | 36.54 mL |
| 5 mM | 0.73 mL | 3.65 mL | 7.31 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
