COX-1 inhibitor
Loading distributor info...
| Description | Catechin is a polyphenolic flavonoid which has been isolated from a variety of natural sources including tea leaves, grape seeds, and the wood and bark of trees such as acacia and mahogany. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12193 |
|---|---|
| Formula | C15H14O6.XH2O |
| Molecular Weight | 290.3 |
| CAS Number | 225937-10-0 |
| SMILES | OC1=CC([C@@H](O2)[C@@H](O)CC3=C2C=C(O)C=C3O)=CC=C1O.O |
| Synonyms | Cyanidol, Catechuic Acid, D-(+)-Catechin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (168.81 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.45 mL | 172.24 mL | 344.47 mL |
| 0.5 mM | 6.89 mL | 34.45 mL | 68.89 mL |
| 1 mM | 3.44 mL | 17.22 mL | 34.45 mL |
| 5 mM | 0.69 mL | 3.44 mL | 6.89 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
