Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Choline bitartrate is a form of the nutrient choline which is found in foods. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16450 |
|---|---|
| Formula | C5H14NO.C4H5O6 |
| Molecular Weight | 253.25 |
| CAS Number | 87-67-2 |
| SMILES | C[N+](C)(C)CCO.C(C(C(=O)[O-])O)(C(=O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 48 mg/mL (189.53 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.49 mL | 197.43 mL | 394.87 mL |
| 0.5 mM | 7.9 mL | 39.49 mL | 78.97 mL |
| 1 mM | 3.95 mL | 19.74 mL | 39.49 mL |
| 5 mM | 0.79 mL | 3.95 mL | 7.9 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
