Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | DAPT (GSI-IX) is an inhibitor of γ-secretase that causes a reduction in Aβ40 and Aβ42 levels in human primary neuronal cultures with IC50 values of 115 and 200 nM for total Aβ and Aβ42 respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10288 |
|---|---|
| Formula | C23H26F2N2O4 |
| Molecular Weight | 432.5 |
| CAS Number | 208255-80-5 |
| SMILES | C[C@@H](C(=O)N[C@@H](C1=CC=CC=C1)C(=O)OC(C)(C)C)NC(=O)CC2=CC(=CC(=C2)F)F |
| Synonyms | GSIIX |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 79 mg/mL (182.67 mM) | |
| Water | Insoluble | ||
| Ethanol | 46 mg/mL (106.36 mM) | ||
| In vivo | 4% DMSO+corn oil | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.12 mL | 115.61 mL | 231.21 mL |
| 0.5 mM | 4.62 mL | 23.12 mL | 46.24 mL |
| 1 mM | 2.31 mL | 11.56 mL | 23.12 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
