Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dbeq is a selective and reversible inhibitor of p97 ATPase (IC50 = 1.5 uM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12736 |
|---|---|
| Formula | C22H20N4 |
| Molecular Weight | 340.42 |
| CAS Number | 177355-84-9 |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=NC3=CC=CC=C32)NCC4=CC=CC=C4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (190.94 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (14.68 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.38 mL | 146.88 mL | 293.75 mL |
| 0.5 mM | 5.88 mL | 29.38 mL | 58.75 mL |
| 1 mM | 2.94 mL | 14.69 mL | 29.38 mL |
| 5 mM | 0.59 mL | 2.94 mL | 5.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
