Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Diclofenac Sodium is a non-selective COX inhibitor with IC50 of 0.5 μg/ml and 0.5 μg/ml for COX-1 and -2 in intact cells, respectively, used as a nonsteroidal anti-inflammatory drug (NSAID) to relieve pain and reduce swelling in flammation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10304 |
|---|---|
| Formula | C14H10Cl2NNaO2 |
| Molecular Weight | 318.13 |
| CAS Number | 15307-79-6 |
| SMILES | C1=CC=C(C(=C1)CC(=O)[O-])NC2=C(C=CC=C2Cl)Cl.[Na+] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (169.74 mM) | |
| Water | 12 mg/mL (37.71 mM) | ||
| Ethanol | 54 mg/mL (169.74 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.43 mL | 157.17 mL | 314.34 mL |
| 0.5 mM | 6.29 mL | 31.43 mL | 62.87 mL |
| 1 mM | 3.14 mL | 15.72 mL | 31.43 mL |
| 5 mM | 0.63 mL | 3.14 mL | 6.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
