Loading distributor info...
| Description | Diclofenac is a potent and nonselective anti-inflammatory agent, acts as a COX inhibitor, with IC50s of 4 nM, 1.3 nM for human COX-1 and COX-2 in CHO cells, and 5.1, 0.84 μM for ovine COX-1 and COX-2, respectively. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A17814 |
|---|---|
| Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.15 |
| CAS Number | 15307-86-5 |
| SMILES | O=C(O)CC1=CC=CC=C1NC2=C(Cl)C=CC=C2Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (182.34 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.77 mL | 168.83 mL | 337.67 mL |
| 0.5 mM | 6.75 mL | 33.77 mL | 67.53 mL |
| 1 mM | 3.38 mL | 16.88 mL | 33.77 mL |
| 5 mM | 0.68 mL | 3.38 mL | 6.75 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
