Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | FLI-06 is a Notch inhibitor and the early secretory pathway inhibitor. FLI-06 disrupts the Golgi apparatus in a manner distinct from that of brefeldin A and golgicide A. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13815 |
|---|---|
| Formula | C25H30N2O5 |
| Molecular Weight | 438.52 |
| CAS Number | 313967-18-9 |
| SMILES | CC1=C(C(C2=C(N1)CC(CC2=O)(C)C)C3=CC=C(C=C3)[N+](=O)[O-])C(=O)OC4CCCCC4 |
| Synonyms | FLI06,FLI 06 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 80 mg/mL (182.43 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (15.96 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.8 mL | 114.02 mL | 228.04 mL |
| 0.5 mM | 4.56 mL | 22.8 mL | 45.61 mL |
| 1 mM | 2.28 mL | 11.4 mL | 22.8 mL |
| 5 mM | 0.46 mL | 2.28 mL | 4.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
