Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GDC-0068 is a selective, ATP-competitive, pan-Akt inhibitor that targets Akt1, 2, and 3 with IC50 values of 5, 18, and 8 nM, respectively in cell-free assays | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11246 |
|---|---|
| Formula | C24H32ClN5O2 |
| Molecular Weight | 458 |
| CAS Number | 1001264-89-6 |
| SMILES | C[C@@H]1C[C@H](C2=C1C(=NC=N2)N3CCN(CC3)C(=O)[C@H](CNC(C)C)C4=CC=C(C=C4)Cl)O |
| Synonyms | GDC0068, RG7440 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (198.69 mM) | |
| Water | Insoluble | ||
| Ethanol | 91 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.83 mL | 109.17 mL | 218.34 mL |
| 0.5 mM | 4.37 mL | 21.83 mL | 43.67 mL |
| 1 mM | 2.18 mL | 10.92 mL | 21.83 mL |
| 5 mM | 0.44 mL | 2.18 mL | 4.37 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
