Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Imatinib mesylate, a selective tyrosine kinase inhibitor, induced a sustained objective response in treating gastrointestinal stromal tumors with the inhibition of the KIT signal-transduction pathway. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10468 |
|---|---|
| Formula | C29H31N7O.CH4SO3 |
| Molecular Weight | 589.7 |
| CAS Number | 220127-57-1 |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5.CS(=O)(=O)O |
| Synonyms | Gleevec, Glivec, CGP-57148B, STI-571 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 101 mg/mL (171.26 mM) | |
| Water | 101 mg/mL (171.26 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.96 mL | 84.79 mL | 169.58 mL |
| 0.5 mM | 3.39 mL | 16.96 mL | 33.92 mL |
| 1 mM | 1.7 mL | 8.48 mL | 16.96 mL |
| 5 mM | 0.34 mL | 1.7 mL | 3.39 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
