Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | L-685458 is a specific and potent inhibitor of A beta PP gamma-secretase activity with Ki of 17 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15899 |
|---|---|
| Formula | C39H52N4O6 |
| Molecular Weight | 672.85 |
| CAS Number | 292632-98-5 |
| SMILES | O=C(OC(C)(C)C)N[C@H]([C@H](O)C[C@@H](CC1=CC=CC=C1)C(N[C@@H](CC(C)C)C(N[C@@H](CC2=CC=CC=C2)C(N)=O)=O)=O)CC3=CC=CC=C3 |
| Synonyms | L685458, L 685458, L685,458 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (127.81 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 5 mg/mL (7.43 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.86 mL | 74.31 mL | 148.62 mL |
| 0.5 mM | 2.97 mL | 14.86 mL | 29.72 mL |
| 1 mM | 1.49 mL | 7.43 mL | 14.86 mL |
| 5 mM | 0.3 mL | 1.49 mL | 2.97 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
