Loading distributor info...
| Description | L-(-)-Fucose is classified as a member of the hexoses, plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interactions. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17896 |
|---|---|
| Formula | C6H12O5 |
| Molecular Weight | 164.15 |
| CAS Number | 2438-80-4 |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C=O |
| Synonyms | L-Fucose; (-)-L-Fucose; Fucosse; 6-Desoxygalactose; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 30 mg/mL (182.75 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 60.92 mL | 304.6 mL | 609.2 mL |
| 0.5 mM | 12.18 mL | 60.92 mL | 121.84 mL |
| 1 mM | 6.09 mL | 30.46 mL | 60.92 mL |
| 5 mM | 1.22 mL | 6.09 mL | 12.18 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
