L-(-)-Fucose
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
Discription | L-(-)-Fucose is classified as a member of the hexoses, plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interactions. | ||
---|---|---|---|
Targets |
|
Catalog Num | A17896 |
---|---|
Formula | C6H12O5 |
Molecular Weight | 164.15 |
CAS Number | 2438-80-4 |
SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C=O |
Synonyms | L-Fucose; (-)-L-Fucose; Fucosse; 6-Desoxygalactose; |
Storage | Store lyophilized at -20ºC, keep desiccated. |
In vitro | DMSO | 30 mg/mL (182.75 mM) | |
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 60.92 mL | 304.6 mL | 609.2 mL |
0.5 mM | 12.18 mL | 60.92 mL | 121.84 mL |
1 mM | 6.09 mL | 30.46 mL | 60.92 mL |
5 mM | 1.22 mL | 6.09 mL | 12.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2