Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | L-Theanine (L-Glutamic Acid ??-ethyl amide??is a non-protein amino acid contained in green tea leaves, which blocks the binding of L-glutamic acid to glutamate receptors in the brain, and with neuroprotective and anti-oxidative activities. |
|---|
| Catalog Num | A21167 |
|---|---|
| Formula | C7H14N2O3 |
| Molecular Weight | 174.2 |
| CAS Number | 3081-61-6 |
| SMILES | OC([C@@H](N)CCC(NCC)=O)=O |
| Synonyms | L-Glutamic Acid ??-ethyl amide; N??-Ethyl-L-glutamine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 33 mg/mL (189.43 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 57.41 mL | 287.03 mL | 574.05 mL |
| 0.5 mM | 11.48 mL | 57.41 mL | 114.81 mL |
| 1 mM | 5.74 mL | 28.7 mL | 57.41 mL |
| 5 mM | 1.15 mL | 5.74 mL | 11.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
