Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lopinavir is an inhibitor of the HIV protease. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10537 |
|---|---|
| Formula | C37H48N4O5 |
| Molecular Weight | 628.8 |
| CAS Number | 192725-17-0 |
| SMILES | CC1=C(C(=CC=C1)C)OCC(=O)N[C@@H](CC2=CC=CC=C2)[C@H](C[C@H](CC3=CC=CC=C3)NC(=O)[C@H](C(C)C)N4CCCNC4=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 116 mg/mL (184.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 116 mg/mL (184.48 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.9 mL | 79.52 mL | 159.03 mL |
| 0.5 mM | 3.18 mL | 15.9 mL | 31.81 mL |
| 1 mM | 1.59 mL | 7.95 mL | 15.9 mL |
| 5 mM | 0.32 mL | 1.59 mL | 3.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
