Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Luteolin is a PDE4 inhibitor, phosphodiesterase inhibitor, and an interleukin 6 inhibitor, affecting xylazine/ketamine-induced anesthesia in mice. Luteolin acts as a monoamine transporter activator, and is one of the few chemicals demonstrated to possess this property. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10541 |
|---|---|
| Formula | C15H10O6 |
| Molecular Weight | 286.2 |
| CAS Number | 491-70-3 |
| SMILES | C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Synonyms | 3',4',5,7-Tetrahydroxyflavone, Luteoline, Luteolol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (192.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 3 mg/mL (10.48 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.94 mL | 174.7 mL | 349.41 mL |
| 0.5 mM | 6.99 mL | 34.94 mL | 69.88 mL |
| 1 mM | 3.49 mL | 17.47 mL | 34.94 mL |
| 5 mM | 0.7 mL | 3.49 mL | 6.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
