Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Marizomib is a naturally-occurring salinosporamide, isolated from the marine actinomycete Salinospora tropica, with potential antineoplastic activity. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A13853 |
|---|---|
| Formula | C15H20ClNO4 |
| Molecular Weight | 313.77 |
| CAS Number | 437742-34-2 |
| SMILES | C[C@]12[C@H](C(=O)N[C@]1(C(=O)O2)[C@H]([C@H]3CCCC=C3)O)CCCl |
| Synonyms | ML 858, Marizomib, NPI 0052, Salinosporamide A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (188.02 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.87 mL | 159.35 mL | 318.7 mL |
| 0.5 mM | 6.37 mL | 31.87 mL | 63.74 mL |
| 1 mM | 3.19 mL | 15.94 mL | 31.87 mL |
| 5 mM | 0.64 mL | 3.19 mL | 6.37 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
