Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MK-886 is an inhibitor of leukotriene biosynthesis (IC50 = 3 nM in human polymorphonuclear leukocytes). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13346 |
|---|---|
| Formula | C27H34ClNO2S |
| Molecular Weight | 472.08 |
| CAS Number | 118414-82-7 |
| SMILES | CC(C)C1=CC2=C(C=C1)N(C(=C2SC(C)(C)C)CC(C)(C)C(=O)O)CC3=CC=C(C=C3)Cl |
| Synonyms | L-663,536, MK-886, MK886, L663536, L-663536 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (180.05 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.18 mL | 105.91 mL | 211.83 mL |
| 0.5 mM | 4.24 mL | 21.18 mL | 42.37 mL |
| 1 mM | 2.12 mL | 10.59 mL | 21.18 mL |
| 5 mM | 0.42 mL | 2.12 mL | 4.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
