Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NGP-555 is a gamma-secretase modulator with a selective mechanism to reduce Abeta 42 while raising shorter Abeta forms such as Abeta 37 and 38. |
|---|
| Catalog Num | A17051 |
|---|---|
| Formula | C23H23FN4S |
| Molecular Weight | 406.52 |
| CAS Number | 1304630-27-0 |
| SMILES | FC1=CC(C2=CSC(NC3=CC(CC)=C(C)C=C3C)=N2)=CC=C1N4C=C(C)N=C4 |
| Synonyms | NGP555, NGP 555 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 38 mg/mL (93.47 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (7.37 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.6 mL | 123 mL | 245.99 mL |
| 0.5 mM | 4.92 mL | 24.6 mL | 49.2 mL |
| 1 mM | 2.46 mL | 12.3 mL | 24.6 mL |
| 5 mM | 0.49 mL | 2.46 mL | 4.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
