Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nicotinamide riboside chloride is a crystal form of Nicotinamide riboside (NR) chloride. Nicotinamide riboside chloride is used in dietary supplements. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A22018 |
|---|---|
| Formula | C11H15ClN2O5 |
| Molecular Weight | 290.7 |
| CAS Number | 23111-00-4 |
| SMILES | NC(C1=C[N+]([C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)=CC=C1)=O.[Cl-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (182.31 mM) | |
| Water | 53 mg/mL (182.31 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.4 mL | 172 mL | 344 mL |
| 0.5 mM | 6.88 mL | 34.4 mL | 68.8 mL |
| 1 mM | 3.44 mL | 17.2 mL | 34.4 mL |
| 5 mM | 0.69 mL | 3.44 mL | 6.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
