Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nimesulide is a relatively COX-2 selective, non-steroidal anti-inflammatory drug (NSAID) with analgesic and antipyretic properties. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11694 |
|---|---|
| Formula | C13H12N2O5S |
| Molecular Weight | 308.31 |
| CAS Number | 51803-78-2 |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])OC2=CC=CC=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (178.39 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.43 mL | 162.17 mL | 324.35 mL |
| 0.5 mM | 6.49 mL | 32.43 mL | 64.87 mL |
| 1 mM | 3.24 mL | 16.22 mL | 32.43 mL |
| 5 mM | 0.65 mL | 3.24 mL | 6.49 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
